CAS:51-44-5|3,4-Dichlorobenzoic Acid
Molecular Formula:C7H4Cl2O2
Molecular Weight:191.01g/mol
EINECS:200-099-2
Purity:98 percent
Package:5g/10g/25g/50g/bulk package
- Maailmanlaajuinen toimitus
- Laatuvakuutus
- 24/7 asiakaspalvelu
Tuotteen esittely
3,4-Dichlorobenzoic acid(CAS:51-44-5) is widely used in scientific research. It is used in the synthesis of other organic compounds, such as 3,4-dichlorobenzamide and 3,4-dichlorobenzyl alcohol. It is also used in the synthesis of pharmaceuticals, such as the anti-inflammatory drug diclofenac. 3,4-DCBA has also been used in studies of enzyme inhibition, protein folding, and DNA binding.
|
|
|
| 3,4-dichlorobenzoic acid | |
| MFCD00002492 | |
| 317.8 degree at 760 mmHg | |
| 204-206 degree (lit.) | |
| 146.0±22.3 degree | |
| 1.5±0.1 g/cm3 | |
| 37.30 | |
| 3.53 | |
| White to off-white to pale cream powder | |
| {{0}}.0±0.7 mmHg at 25 degree | |
| 1.599 | |
| InChI=1S/C7H4Cl2O2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H,10,11) | |
| VPHHJAOJUJHJKD-UHFFFAOYSA-N |
Suositut Tagit: cas:51-44-5|3,4-dichlorobenzoic acid, price, quotation, discount, in stock, for sale
